C19H23N3O — CID 9462299
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-pyrazol-1-ylphenyl)methanone (PubChem CID 9462299) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-pyrazol-1-ylphenyl)methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-pyrazol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 9462299 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-pyrazol-1-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-n2cccn2)cc1)N1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C19H23N3O/c23-19(21-13-10-15-4-1-2-5-17(15)14-21)16-6-8-18(9-7-16)22-12-3-11-20-22/h3,6-9,11-12,15,17H,1-2,4-5,10,13-14H2/t15-,17+/m0/s1 |
| InChIKey | COWOELBGZXKGSO-DOTOQJQBSA-N |
| XLogP | 3.52 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |