C18H22N4O — CID 95584354
[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-pyrazol-1-yl-3-pyridinyl)methanone (PubChem CID 95584354) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-pyrazol-1-yl-3-pyridinyl)methanone.
| Compound Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-pyrazol-1-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 95584354 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-pyrazol-1-yl-3-pyridinyl)methanone |
| SMILES | O=C(c1cccnc1-n1cccn1)N1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C18H22N4O/c23-18(21-12-8-14-5-1-2-6-15(14)13-21)16-7-3-9-19-17(16)22-11-4-10-20-22/h3-4,7,9-11,14-15H,1-2,5-6,8,12-13H2/t14-,15-/m1/s1 |
| InChIKey | GHEOONQCCUFECT-HUUCEWRRSA-N |
| XLogP | 2.92 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |