C19H28N3O+ — CID 9489950
[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-pyrrolidin-1-ylpyridin-1-ium-3-yl)methanone (PubChem CID 9489950) has the molecular formula C19H28N3O+ and a molecular weight of 314.45 g/mol. Its IUPAC name is [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-pyrrolidin-1-ylpyridin-1-ium-3-yl)methanone.
| Compound Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-pyrrolidin-1-ylpyridin-1-ium-3-yl)methanone |
|---|---|
| PubChem CID | 9489950 |
| Molecular Formula | C19H28N3O+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-pyrrolidin-1-ylpyridin-1-ium-3-yl)methanone |
| SMILES | O=C(c1ccc[nH+]c1N1CCCC1)N1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C19H27N3O/c23-19(22-13-9-15-6-1-2-7-16(15)14-22)17-8-5-10-20-18(17)21-11-3-4-12-21/h5,8,10,15-16H,1-4,6-7,9,11-14H2/p+1/t15-,16-/m1/s1 |
| InChIKey | YQXXBFOHENQFQD-HZPDHXFCSA-O |
| XLogP | 2.75 |
| TPSA | 37.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |