C19H24N2O — CID 9225632
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(1-methylindol-3-yl)methanone (PubChem CID 9225632) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(1-methylindol-3-yl)methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(1-methylindol-3-yl)methanone |
|---|---|
| PubChem CID | 9225632 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(1-methylindol-3-yl)methanone |
| SMILES | Cn1cc(C(=O)N2CC[C@@H]3CCCC[C@H]3C2)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O/c1-20-13-17(16-8-4-5-9-18(16)20)19(22)21-11-10-14-6-2-3-7-15(14)12-21/h4-5,8-9,13-15H,2-3,6-7,10-12H2,1H3/t14-,15-/m0/s1 |
| InChIKey | PZRJOCKTZUOTMU-GJZGRUSLSA-N |
| XLogP | 3.83 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |