C22H24N4O — CID 75258654
(1-methylindol-3-yl)-(3-phenyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)methanone (PubChem CID 75258654) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is (1-methylindol-3-yl)-(3-phenyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)methanone.
| Compound Name | (1-methylindol-3-yl)-(3-phenyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 75258654 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (1-methylindol-3-yl)-(3-phenyl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)methanone |
| SMILES | Cn1cc(C(=O)N2CCC3NNC(c4ccccc4)C3C2)c2ccccc21 |
| InChI | InChI=1S/C22H24N4O/c1-25-13-17(16-9-5-6-10-20(16)25)22(27)26-12-11-19-18(14-26)21(24-23-19)15-7-3-2-4-8-15/h2-10,13,18-19,21,23-24H,11-12,14H2,1H3 |
| InChIKey | HGCJHKMYXZIAMD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |