C21H23NO2S — CID 9489927
[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]-thiophen-2-ylmethanone (PubChem CID 9489927) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]-thiophen-2-ylmethanone.
| Compound Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 9489927 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)c1ccccc1C(=O)N1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C21H23NO2S/c23-20(19-10-5-13-25-19)17-8-3-4-9-18(17)21(24)22-12-11-15-6-1-2-7-16(15)14-22/h3-5,8-10,13,15-16H,1-2,6-7,11-12,14H2/t15-,16-/m1/s1 |
| InChIKey | DSJOTQFOLJTQEO-HZPDHXFCSA-N |
| XLogP | 4.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |