C23H25N3O — CID 40716447
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-(benzimidazol-1-yl)phenyl]methanone (PubChem CID 40716447) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-(benzimidazol-1-yl)phenyl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-(benzimidazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 40716447 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-(benzimidazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-n2cnc3ccccc32)cc1)N1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C23H25N3O/c27-23(25-14-13-17-5-1-2-6-19(17)15-25)18-9-11-20(12-10-18)26-16-24-21-7-3-4-8-22(21)26/h3-4,7-12,16-17,19H,1-2,5-6,13-15H2/t17-,19+/m0/s1 |
| InChIKey | SEVZOONAAWEDOF-PKOBYXMFSA-N |
| XLogP | 4.68 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |