C16H22N4O2 — CID 119662618
[4-(3-aminopropoxy)piperidin-1-yl]-imidazo[1,2-a]pyridin-6-ylmethanone (PubChem CID 119662618) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-imidazo[1,2-a]pyridin-6-ylmethanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-imidazo[1,2-a]pyridin-6-ylmethanone |
|---|---|
| PubChem CID | 119662618 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-imidazo[1,2-a]pyridin-6-ylmethanone |
| SMILES | NCCCOC1CCN(C(=O)c2ccc3nccn3c2)CC1 |
| InChI | InChI=1S/C16H22N4O2/c17-6-1-11-22-14-4-8-19(9-5-14)16(21)13-2-3-15-18-7-10-20(15)12-13/h2-3,7,10,12,14H,1,4-6,8-9,11,17H2 |
| InChIKey | WQRDFIOXDZJICY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|