C12H19N3O3 — CID 115824313
[4-(3-aminopropoxy)piperidin-1-yl]-(1,2-oxazol-5-yl)methanone (PubChem CID 115824313) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(1,2-oxazol-5-yl)methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 115824313 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(1,2-oxazol-5-yl)methanone |
| SMILES | NCCCOC1CCN(C(=O)c2ccno2)CC1 |
| InChI | InChI=1S/C12H19N3O3/c13-5-1-9-17-10-3-7-15(8-4-10)12(16)11-2-6-14-18-11/h2,6,10H,1,3-5,7-9,13H2 |
| InChIKey | LZULFEMQXOTKOJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|