C17H29N3O3 — CID 119661859
[4-(3-aminopropoxy)piperidin-1-yl]-(3-pentan-3-yl-1,2-oxazol-5-yl)methanone (PubChem CID 119661859) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(3-pentan-3-yl-1,2-oxazol-5-yl)methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(3-pentan-3-yl-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 119661859 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(3-pentan-3-yl-1,2-oxazol-5-yl)methanone |
| SMILES | CCC(CC)c1cc(C(=O)N2CCC(OCCCN)CC2)on1 |
| InChI | InChI=1S/C17H29N3O3/c1-3-13(4-2)15-12-16(23-19-15)17(21)20-9-6-14(7-10-20)22-11-5-8-18/h12-14H,3-11,18H2,1-2H3 |
| InChIKey | JOELRTURJVFKCK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|