C16H24Cl2F3N3O3 — CID 119661860
[4-(3-aminopropoxy)piperidin-1-yl]-[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]methanone;dihydrochloride (PubChem CID 119661860) has the molecular formula C16H24Cl2F3N3O3 and a molecular weight of 434.29 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]methanone;dihydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119661860 |
| Molecular Formula | C16H24Cl2F3N3O3 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[3-(2,2,2-trifluoroethoxy)-2-pyridinyl]methanone;dihydrochloride |
| SMILES | Cl.Cl.NCCCOC1CCN(C(=O)c2ncccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F3N3O3.2ClH/c17-16(18,19)11-25-13-3-1-7-21-14(13)15(23)22-8-4-12(5-9-22)24-10-2-6-20;;/h1,3,7,12H,2,4-6,8-11,20H2;2*1H |
| InChIKey | XJSCWKHROGVKKB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|