C16H21ClN4O2 — CID 134793891
N-(4-chlorophenyl)-4-(2-oxo-1,3-diazinan-1-yl)piperidine-1-carboxamide (PubChem CID 134793891) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(2-oxo-1,3-diazinan-1-yl)piperidine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-(2-oxo-1,3-diazinan-1-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 134793891 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-(4-chlorophenyl)-4-(2-oxo-1,3-diazinan-1-yl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)N1CCC(N2CCCNC2=O)CC1 |
| InChI | InChI=1S/C16H21ClN4O2/c17-12-2-4-13(5-3-12)19-16(23)20-10-6-14(7-11-20)21-9-1-8-18-15(21)22/h2-5,14H,1,6-11H2,(H,18,22)(H,19,23) |
| InChIKey | FTIVZRHTVFDNMB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |