C14H19ClN4O — CID 66196929
N-(4-chlorophenyl)-3-piperazin-1-ylazetidine-1-carboxamide (PubChem CID 66196929) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-piperazin-1-ylazetidine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-3-piperazin-1-ylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 66196929 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(4-chlorophenyl)-3-piperazin-1-ylazetidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C14H19ClN4O/c15-11-1-3-12(4-2-11)17-14(20)19-9-13(10-19)18-7-5-16-6-8-18/h1-4,13,16H,5-10H2,(H,17,20) |
| InChIKey | BSQQJJOKOPJGAX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |