C15H20ClN3O — CID 82883104
(5-chloro-2-methylphenyl)-(3-piperazin-1-ylazetidin-1-yl)methanone (PubChem CID 82883104) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is (5-chloro-2-methylphenyl)-(3-piperazin-1-ylazetidin-1-yl)methanone.
| Compound Name | (5-chloro-2-methylphenyl)-(3-piperazin-1-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 82883104 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (5-chloro-2-methylphenyl)-(3-piperazin-1-ylazetidin-1-yl)methanone |
| SMILES | Cc1ccc(Cl)cc1C(=O)N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C15H20ClN3O/c1-11-2-3-12(16)8-14(11)15(20)19-9-13(10-19)18-6-4-17-5-7-18/h2-3,8,13,17H,4-7,9-10H2,1H3 |
| InChIKey | RMYANIZXFWCEHS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |