C14H16F3N3O — CID 66203787
(3-piperazin-1-ylazetidin-1-yl)-(2,4,6-trifluorophenyl)methanone (PubChem CID 66203787) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is (3-piperazin-1-ylazetidin-1-yl)-(2,4,6-trifluorophenyl)methanone.
| Compound Name | (3-piperazin-1-ylazetidin-1-yl)-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 66203787 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3-piperazin-1-ylazetidin-1-yl)-(2,4,6-trifluorophenyl)methanone |
| SMILES | O=C(c1c(F)cc(F)cc1F)N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C14H16F3N3O/c15-9-5-11(16)13(12(17)6-9)14(21)20-7-10(8-20)19-3-1-18-2-4-19/h5-6,10,18H,1-4,7-8H2 |
| InChIKey | AZAFTBUDYDTPOU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |