C11H12F2N2O2 — CID 82511555
(2,4-difluoro-6-hydroxyphenyl)-piperazin-1-ylmethanone (PubChem CID 82511555) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is (2,4-difluoro-6-hydroxyphenyl)-piperazin-1-ylmethanone.
| Compound Name | (2,4-difluoro-6-hydroxyphenyl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 82511555 |
| Molecular Formula | C11H12F2N2O2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (2,4-difluoro-6-hydroxyphenyl)-piperazin-1-ylmethanone |
| SMILES | O=C(c1c(O)cc(F)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C11H12F2N2O2/c12-7-5-8(13)10(9(16)6-7)11(17)15-3-1-14-2-4-15/h5-6,14,16H,1-4H2 |
| InChIKey | ILSFGVROARWDTL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |