C17H22N4O4 — CID 90342459
3,5-bis(piperazine-1-carbonyl)benzoic acid (PubChem CID 90342459) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3,5-bis(piperazine-1-carbonyl)benzoic acid.
| Compound Name | 3,5-bis(piperazine-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 90342459 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3,5-bis(piperazine-1-carbonyl)benzoic acid |
| SMILES | O=C(O)c1cc(C(=O)N2CCNCC2)cc(C(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H22N4O4/c22-15(20-5-1-18-2-6-20)12-9-13(11-14(10-12)17(24)25)16(23)21-7-3-19-4-8-21/h9-11,18-19H,1-8H2,(H,24,25) |
| InChIKey | VPPDAPUTAMJLRI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |