C19H30N2O2 — CID 14300314
(3,5-ditert-butyl-4-hydroxyphenyl)-piperazin-1-ylmethanone (PubChem CID 14300314) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)-piperazin-1-ylmethanone.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 14300314 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)-piperazin-1-ylmethanone |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCNCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H30N2O2/c1-18(2,3)14-11-13(12-15(16(14)22)19(4,5)6)17(23)21-9-7-20-8-10-21/h11-12,20,22H,7-10H2,1-6H3 |
| InChIKey | CCHIUDWAGIDUCN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |