C11H10F3NOS — CID 164512728
thiomorpholin-4-yl-(2,4,6-trifluorophenyl)methanone (PubChem CID 164512728) has the molecular formula C11H10F3NOS and a molecular weight of 261.27 g/mol. Its IUPAC name is thiomorpholin-4-yl-(2,4,6-trifluorophenyl)methanone.
| Compound Name | thiomorpholin-4-yl-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 164512728 |
| Molecular Formula | C11H10F3NOS |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | thiomorpholin-4-yl-(2,4,6-trifluorophenyl)methanone |
| SMILES | O=C(c1c(F)cc(F)cc1F)N1CCSCC1 |
| InChI | InChI=1S/C11H10F3NOS/c12-7-5-8(13)10(9(14)6-7)11(16)15-1-3-17-4-2-15/h5-6H,1-4H2 |
| InChIKey | NWQAIBGYSKRHGQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |