C19H20F2N2O3 — CID 86861764
(2,4-difluoro-6-hydroxyphenyl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone (PubChem CID 86861764) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is (2,4-difluoro-6-hydroxyphenyl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (2,4-difluoro-6-hydroxyphenyl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 86861764 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2,4-difluoro-6-hydroxyphenyl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
| SMILES | COc1ccc(N2CCCN(C(=O)c3c(O)cc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C19H20F2N2O3/c1-26-15-5-3-14(4-6-15)22-7-2-8-23(10-9-22)19(25)18-16(21)11-13(20)12-17(18)24/h3-6,11-12,24H,2,7-10H2,1H3 |
| InChIKey | GQBXWKJHNMXQOL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|