C18H18F2N2O2 — CID 896999
(2,6-difluorophenyl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 896999) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is (2,6-difluorophenyl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (2,6-difluorophenyl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 896999 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (2,6-difluorophenyl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3c(F)cccc3F)CC2)cc1 |
| InChI | InChI=1S/C18H18F2N2O2/c1-24-14-7-5-13(6-8-14)21-9-11-22(12-10-21)18(23)17-15(19)3-2-4-16(17)20/h2-8H,9-12H2,1H3 |
| InChIKey | NRWVUUPZLFLTNY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|