C15H20BrClFN3O — CID 120995836
(3-bromo-5-fluorophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 120995836) has the molecular formula C15H20BrClFN3O and a molecular weight of 392.70 g/mol. Its IUPAC name is (3-bromo-5-fluorophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | (3-bromo-5-fluorophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120995836 |
| Molecular Formula | C15H20BrClFN3O |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (3-bromo-5-fluorophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cc(F)cc(Br)c1)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C15H19BrFN3O.ClH/c16-12-7-11(8-13(17)9-12)15(21)20-4-1-14(10-20)19-5-2-18-3-6-19;/h7-9,14,18H,1-6,10H2;1H |
| InChIKey | HEANWCGGYSIAHC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |