C15H20BrClN4O3 — CID 120995986
(3-bromo-5-nitrophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 120995986) has the molecular formula C15H20BrClN4O3 and a molecular weight of 419.71 g/mol. Its IUPAC name is (3-bromo-5-nitrophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | (3-bromo-5-nitrophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120995986 |
| Molecular Formula | C15H20BrClN4O3 |
| Molecular Weight | 419.71 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | (3-bromo-5-nitrophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cc(Br)cc([N+](=O)[O-])c1)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C15H19BrN4O3.ClH/c16-12-7-11(8-14(9-12)20(22)23)15(21)19-4-1-13(10-19)18-5-2-17-3-6-18;/h7-9,13,17H,1-6,10H2;1H |
| InChIKey | JWTBEMGCFUKIQT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.71 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|