C13H19ClN4O3S — CID 120997241
(5-nitrothiophen-3-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 120997241) has the molecular formula C13H19ClN4O3S and a molecular weight of 346.84 g/mol. Its IUPAC name is (5-nitrothiophen-3-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | (5-nitrothiophen-3-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120997241 |
| Molecular Formula | C13H19ClN4O3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (5-nitrothiophen-3-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1csc([N+](=O)[O-])c1)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C13H18N4O3S.ClH/c18-13(10-7-12(17(19)20)21-9-10)16-4-1-11(8-16)15-5-2-14-3-6-15;/h7,9,11,14H,1-6,8H2;1H |
| InChIKey | UMPLNXZQGWTLCD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|