C11H16ClN3O3S — CID 119541104
[3-(methylaminomethyl)pyrrolidin-1-yl]-(5-nitrothiophen-3-yl)methanone;hydrochloride (PubChem CID 119541104) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is [3-(methylaminomethyl)pyrrolidin-1-yl]-(5-nitrothiophen-3-yl)methanone;hydrochloride.
| Compound Name | [3-(methylaminomethyl)pyrrolidin-1-yl]-(5-nitrothiophen-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119541104 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | [3-(methylaminomethyl)pyrrolidin-1-yl]-(5-nitrothiophen-3-yl)methanone;hydrochloride |
| SMILES | CNCC1CCN(C(=O)c2csc([N+](=O)[O-])c2)C1.Cl |
| InChI | InChI=1S/C11H15N3O3S.ClH/c1-12-5-8-2-3-13(6-8)11(15)9-4-10(14(16)17)18-7-9;/h4,7-8,12H,2-3,5-6H2,1H3;1H |
| InChIKey | PYBULZJRCCUZAQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|