C11H12N2O5S — CID 78925309
(3S)-1-(5-nitrothiophene-3-carbonyl)piperidine-3-carboxylic acid (PubChem CID 78925309) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is (3S)-1-(5-nitrothiophene-3-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(5-nitrothiophene-3-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 78925309 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (3S)-1-(5-nitrothiophene-3-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2csc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C11H12N2O5S/c14-10(8-4-9(13(17)18)19-6-8)12-3-1-2-7(5-12)11(15)16/h4,6-7H,1-3,5H2,(H,15,16)/t7-/m0/s1 |
| InChIKey | QNWICXTXUPFJAY-ZETCQYMHSA-N |
| XLogP | 1.59 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|