C12H15BrClFN2O — CID 119576853
(3-bromo-5-fluorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119576853) has the molecular formula C12H15BrClFN2O and a molecular weight of 337.62 g/mol. Its IUPAC name is (3-bromo-5-fluorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (3-bromo-5-fluorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119576853 |
| Molecular Formula | C12H15BrClFN2O |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (3-bromo-5-fluorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2cc(F)cc(Br)c2)CCN1.Cl |
| InChI | InChI=1S/C12H14BrFN2O.ClH/c1-8-7-16(3-2-15-8)12(17)9-4-10(13)6-11(14)5-9;/h4-6,8,15H,2-3,7H2,1H3;1H |
| InChIKey | RJIHBUMUOXALMG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |