C18H26BFN2O3 — CID 176731032
[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3-methylpiperazin-1-yl)methanone (PubChem CID 176731032) has the molecular formula C18H26BFN2O3 and a molecular weight of 348.23 g/mol. Its IUPAC name is [3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3-methylpiperazin-1-yl)methanone.
| Compound Name | [3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 176731032 |
| Molecular Formula | C18H26BFN2O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3-methylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(F)cc(B3OC(C)(C)C(C)(C)O3)c2)CCN1 |
| InChI | InChI=1S/C18H26BFN2O3/c1-12-11-22(7-6-21-12)16(23)13-8-14(10-15(20)9-13)19-24-17(2,3)18(4,5)25-19/h8-10,12,21H,6-7,11H2,1-5H3 |
| InChIKey | RZTSOAOCMQCQKK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|