C18H27BCl2N2O3 — CID 176731369
[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[(3S)-3-methylpiperazin-1-yl]methanone;hydrochloride (PubChem CID 176731369) has the molecular formula C18H27BCl2N2O3 and a molecular weight of 401.14 g/mol. Its IUPAC name is [3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[(3S)-3-methylpiperazin-1-yl]methanone;hydrochloride.
| Compound Name | [3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[(3S)-3-methylpiperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 176731369 |
| Molecular Formula | C18H27BCl2N2O3 |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[(3S)-3-methylpiperazin-1-yl]methanone;hydrochloride |
| SMILES | C[C@H]1CN(C(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)c(Cl)c2)CCN1.Cl |
| InChI | InChI=1S/C18H26BClN2O3.ClH/c1-12-11-22(9-8-21-12)16(23)13-6-7-14(15(20)10-13)19-24-17(2,3)18(4,5)25-19;/h6-7,10,12,21H,8-9,11H2,1-5H3;1H/t12-;/m0./s1 |
| InChIKey | OMRWEJXLOVWJEU-YDALLXLXSA-N |
| XLogP | 2.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|