C18H26BClN2O3 — CID 176731232
[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[(3S)-3-methylpiperazin-1-yl]methanone (PubChem CID 176731232) has the molecular formula C18H26BClN2O3 and a molecular weight of 364.68 g/mol. Its IUPAC name is [2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[(3S)-3-methylpiperazin-1-yl]methanone.
| Compound Name | [2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[(3S)-3-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 176731232 |
| Molecular Formula | C18H26BClN2O3 |
| Molecular Weight | 364.68 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[(3S)-3-methylpiperazin-1-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2Cl)CCN1 |
| InChI | InChI=1S/C18H26BClN2O3/c1-12-11-22(9-8-21-12)16(23)14-7-6-13(10-15(14)20)19-24-17(2,3)18(4,5)25-19/h6-7,10,12,21H,8-9,11H2,1-5H3/t12-/m0/s1 |
| InChIKey | DKIVXWRQGZZEDU-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.68 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|