C19H27BClNO4 — CID 170991950
[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(4-methoxypiperidin-1-yl)methanone (PubChem CID 170991950) has the molecular formula C19H27BClNO4 and a molecular weight of 379.69 g/mol. Its IUPAC name is [2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(4-methoxypiperidin-1-yl)methanone.
| Compound Name | [2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(4-methoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 170991950 |
| Molecular Formula | C19H27BClNO4 |
| Molecular Weight | 379.69 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | [2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(4-methoxypiperidin-1-yl)methanone |
| SMILES | COC1CCN(C(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2Cl)CC1 |
| InChI | InChI=1S/C19H27BClNO4/c1-18(2)19(3,4)26-20(25-18)13-6-7-15(16(21)12-13)17(23)22-10-8-14(24-5)9-11-22/h6-7,12,14H,8-11H2,1-5H3 |
| InChIKey | BREFYDIJTDJBPJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|