C17H24BFN2O3 — CID 176731091
[(3R)-3-aminopyrrolidin-1-yl]-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 176731091) has the molecular formula C17H24BFN2O3 and a molecular weight of 334.20 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 176731091 |
| Molecular Formula | C17H24BFN2O3 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)N3CC[C@@H](N)C3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C17H24BFN2O3/c1-16(2)17(3,4)24-18(23-16)11-5-6-13(14(19)9-11)15(22)21-8-7-12(20)10-21/h5-6,9,12H,7-8,10,20H2,1-4H3/t12-/m1/s1 |
| InChIKey | VVJNXMXERNJUEY-GFCCVEGCSA-N |
| XLogP | 1.30 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|