C18H25BFNO4 — CID 164886377
[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 164886377) has the molecular formula C18H25BFNO4 and a molecular weight of 349.21 g/mol. Its IUPAC name is [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 164886377 |
| Molecular Formula | C18H25BFNO4 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)N3CCC(O)CC3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C18H25BFNO4/c1-17(2)18(3,4)25-19(24-17)12-5-6-14(15(20)11-12)16(23)21-9-7-13(22)8-10-21/h5-6,11,13,22H,7-10H2,1-4H3 |
| InChIKey | WQCLDLIVJDFBDR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|