C18H24ClFN2O2 — CID 90616295
(2-chloro-4-fluorophenyl)-[4-(4-methoxypiperidin-1-yl)piperidin-1-yl]methanone (PubChem CID 90616295) has the molecular formula C18H24ClFN2O2 and a molecular weight of 354.85 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[4-(4-methoxypiperidin-1-yl)piperidin-1-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[4-(4-methoxypiperidin-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90616295 |
| Molecular Formula | C18H24ClFN2O2 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[4-(4-methoxypiperidin-1-yl)piperidin-1-yl]methanone |
| SMILES | COC1CCN(C2CCN(C(=O)c3ccc(F)cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C18H24ClFN2O2/c1-24-15-6-10-21(11-7-15)14-4-8-22(9-5-14)18(23)16-3-2-13(20)12-17(16)19/h2-3,12,14-15H,4-11H2,1H3 |
| InChIKey | YRDLIHLRVOYXSW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |