C15H14ClFN2O3S — CID 121156899
3-[1-(2-chloro-4-fluorobenzoyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121156899) has the molecular formula C15H14ClFN2O3S and a molecular weight of 356.81 g/mol. Its IUPAC name is 3-[1-(2-chloro-4-fluorobenzoyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-(2-chloro-4-fluorobenzoyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121156899 |
| Molecular Formula | C15H14ClFN2O3S |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 3-[1-(2-chloro-4-fluorobenzoyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCC(N2C(=O)CSC2=O)CC1 |
| InChI | InChI=1S/C15H14ClFN2O3S/c16-12-7-9(17)1-2-11(12)14(21)18-5-3-10(4-6-18)19-13(20)8-23-15(19)22/h1-2,7,10H,3-6,8H2 |
| InChIKey | RQRNXODEJLYOPQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|