C13H13ClN2O3S2 — CID 121156884
3-[1-(5-chlorothiophene-2-carbonyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121156884) has the molecular formula C13H13ClN2O3S2 and a molecular weight of 344.85 g/mol. Its IUPAC name is 3-[1-(5-chlorothiophene-2-carbonyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-(5-chlorothiophene-2-carbonyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121156884 |
| Molecular Formula | C13H13ClN2O3S2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 3-[1-(5-chlorothiophene-2-carbonyl)piperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(c1ccc(Cl)s1)N1CCC(N2C(=O)CSC2=O)CC1 |
| InChI | InChI=1S/C13H13ClN2O3S2/c14-10-2-1-9(21-10)12(18)15-5-3-8(4-6-15)16-11(17)7-20-13(16)19/h1-2,8H,3-7H2 |
| InChIKey | QYNWPKJCHFIUNU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|