C15H17N3O5S2 — CID 121157013
4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)piperidine-1-carbonyl]benzenesulfonamide (PubChem CID 121157013) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)piperidine-1-carbonyl]benzenesulfonamide.
| Compound Name | 4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)piperidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121157013 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 4-[4-(2,4-dioxo-1,3-thiazolidin-3-yl)piperidine-1-carbonyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N2CCC(N3C(=O)CSC3=O)CC2)cc1 |
| InChI | InChI=1S/C15H17N3O5S2/c16-25(22,23)12-3-1-10(2-4-12)14(20)17-7-5-11(6-8-17)18-13(19)9-24-15(18)21/h1-4,11H,5-9H2,(H2,16,22,23) |
| InChIKey | DIQVNPVUFYITPU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|