C16H18N2O5S2 — CID 121157176
3-[1-(4-acetylphenyl)sulfonylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121157176) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-[1-(4-acetylphenyl)sulfonylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-(4-acetylphenyl)sulfonylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121157176 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 3-[1-(4-acetylphenyl)sulfonylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC(N3C(=O)CSC3=O)CC2)cc1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-11(19)12-2-4-14(5-3-12)25(22,23)17-8-6-13(7-9-17)18-15(20)10-24-16(18)21/h2-5,13H,6-10H2,1H3 |
| InChIKey | ZBMOVCGFUYBXOL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|