C14H15FN2O4S2 — CID 121157155
3-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121157155) has the molecular formula C14H15FN2O4S2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121157155 |
| Molecular Formula | C14H15FN2O4S2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 3-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H15FN2O4S2/c15-10-1-3-12(4-2-10)23(20,21)16-7-5-11(6-8-16)17-13(18)9-22-14(17)19/h1-4,11H,5-9H2 |
| InChIKey | HNSNVSFMNDBMST-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|