C20H23ClN2O3S — CID 121156930
3-[1-[1-(4-chlorophenyl)cyclopentanecarbonyl]piperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121156930) has the molecular formula C20H23ClN2O3S and a molecular weight of 406.94 g/mol. Its IUPAC name is 3-[1-[1-(4-chlorophenyl)cyclopentanecarbonyl]piperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-[1-(4-chlorophenyl)cyclopentanecarbonyl]piperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121156930 |
| Molecular Formula | C20H23ClN2O3S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 3-[1-[1-(4-chlorophenyl)cyclopentanecarbonyl]piperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1C1CCN(C(=O)C2(c3ccc(Cl)cc3)CCCC2)CC1 |
| InChI | InChI=1S/C20H23ClN2O3S/c21-15-5-3-14(4-6-15)20(9-1-2-10-20)18(25)22-11-7-16(8-12-22)23-17(24)13-27-19(23)26/h3-6,16H,1-2,7-13H2 |
| InChIKey | VSUFBUKONKHYRM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|