C12H12ClFN2O2 — CID 25269089
4-(2-chloro-4-fluorobenzoyl)-1-methylpiperazin-2-one (PubChem CID 25269089) has the molecular formula C12H12ClFN2O2 and a molecular weight of 270.69 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorobenzoyl)-1-methylpiperazin-2-one.
| Compound Name | 4-(2-chloro-4-fluorobenzoyl)-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 25269089 |
| Molecular Formula | C12H12ClFN2O2 |
| Molecular Weight | 270.69 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 4-(2-chloro-4-fluorobenzoyl)-1-methylpiperazin-2-one |
| SMILES | CN1CCN(C(=O)c2ccc(F)cc2Cl)CC1=O |
| InChI | InChI=1S/C12H12ClFN2O2/c1-15-4-5-16(7-11(15)17)12(18)9-3-2-8(14)6-10(9)13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | JHRRFWONVSWQOK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.69 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |