C15H18ClFN2O2S — CID 94413455
(2S)-1-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-methylsulfanylpropan-1-one (PubChem CID 94413455) has the molecular formula C15H18ClFN2O2S and a molecular weight of 344.84 g/mol. Its IUPAC name is (2S)-1-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-methylsulfanylpropan-1-one.
| Compound Name | (2S)-1-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-methylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 94413455 |
| Molecular Formula | C15H18ClFN2O2S |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (2S)-1-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-methylsulfanylpropan-1-one |
| SMILES | CS[C@@H](C)C(=O)N1CCN(C(=O)c2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C15H18ClFN2O2S/c1-10(22-2)14(20)18-5-7-19(8-6-18)15(21)12-4-3-11(17)9-13(12)16/h3-4,9-10H,5-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | LHRBHHWBHJCRBY-JTQLQIEISA-N |
| XLogP | 2.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |