C18H23ClFN3O3 — CID 120790448
2-amino-1-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-(oxan-4-yl)ethanone (PubChem CID 120790448) has the molecular formula C18H23ClFN3O3 and a molecular weight of 383.85 g/mol. Its IUPAC name is 2-amino-1-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-(oxan-4-yl)ethanone.
| Compound Name | 2-amino-1-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 120790448 |
| Molecular Formula | C18H23ClFN3O3 |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-amino-1-[4-(2-chloro-4-fluorobenzoyl)piperazin-1-yl]-2-(oxan-4-yl)ethanone |
| SMILES | NC(C(=O)N1CCN(C(=O)c2ccc(F)cc2Cl)CC1)C1CCOCC1 |
| InChI | InChI=1S/C18H23ClFN3O3/c19-15-11-13(20)1-2-14(15)17(24)22-5-7-23(8-6-22)18(25)16(21)12-3-9-26-10-4-12/h1-2,11-12,16H,3-10,21H2 |
| InChIKey | SCPCGDVZLZPXQA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |