C19H16ClF3N2O3 — CID 55548039
(2-chloro-4-fluorophenyl)-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]methanone (PubChem CID 55548039) has the molecular formula C19H16ClF3N2O3 and a molecular weight of 412.80 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55548039 |
| Molecular Formula | C19H16ClF3N2O3 |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCN(C(=O)c2ccccc2OC(F)F)CC1 |
| InChI | InChI=1S/C19H16ClF3N2O3/c20-15-11-12(21)5-6-13(15)17(26)24-7-9-25(10-8-24)18(27)14-3-1-2-4-16(14)28-19(22)23/h1-6,11,19H,7-10H2 |
| InChIKey | LQFBDWXVCHIHGI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |