C13H15FN2O3 — CID 102889204
4-(5-fluoro-2-hydroxybenzoyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102889204) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is 4-(5-fluoro-2-hydroxybenzoyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(5-fluoro-2-hydroxybenzoyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102889204 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-(5-fluoro-2-hydroxybenzoyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)c2cc(F)ccc2O)CC1=O |
| InChI | InChI=1S/C13H15FN2O3/c1-15-5-2-6-16(8-12(15)18)13(19)10-7-9(14)3-4-11(10)17/h3-4,7,17H,2,5-6,8H2,1H3 |
| InChIKey | QISFPQGIBHYULQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |