C13H14FN3O4 — CID 102888779
4-(2-fluoro-5-nitrobenzoyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102888779) has the molecular formula C13H14FN3O4 and a molecular weight of 295.27 g/mol. Its IUPAC name is 4-(2-fluoro-5-nitrobenzoyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(2-fluoro-5-nitrobenzoyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102888779 |
| Molecular Formula | C13H14FN3O4 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-(2-fluoro-5-nitrobenzoyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)c2cc([N+](=O)[O-])ccc2F)CC1=O |
| InChI | InChI=1S/C13H14FN3O4/c1-15-5-2-6-16(8-12(15)18)13(19)10-7-9(17(20)21)3-4-11(10)14/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | NGVOPHSYQZYYRH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|