C12H10FN5O3 — CID 63938093
6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-(2-fluoro-5-nitrophenyl)methanone (PubChem CID 63938093) has the molecular formula C12H10FN5O3 and a molecular weight of 291.24 g/mol. Its IUPAC name is 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-(2-fluoro-5-nitrophenyl)methanone.
| Compound Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-(2-fluoro-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 63938093 |
| Molecular Formula | C12H10FN5O3 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-(2-fluoro-5-nitrophenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1F)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C12H10FN5O3/c13-10-2-1-8(18(20)21)5-9(10)12(19)16-3-4-17-7-14-15-11(17)6-16/h1-2,5,7H,3-4,6H2 |
| InChIKey | SMVFCLXQQBMWDI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|