C14H16FN3O3 — CID 102680252
1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(2-fluoro-5-nitrophenyl)methanone (PubChem CID 102680252) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(2-fluoro-5-nitrophenyl)methanone.
| Compound Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(2-fluoro-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 102680252 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(2-fluoro-5-nitrophenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1F)N1CC2CCCNC2C1 |
| InChI | InChI=1S/C14H16FN3O3/c15-12-4-3-10(18(20)21)6-11(12)14(19)17-7-9-2-1-5-16-13(9)8-17/h3-4,6,9,13,16H,1-2,5,7-8H2 |
| InChIKey | YYHBQYSAAOYLQD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|