C13H16N4O4 — CID 102683457
6-(2,4-dinitrophenyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102683457) has the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 6-(2,4-dinitrophenyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 6-(2,4-dinitrophenyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102683457 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 6-(2,4-dinitrophenyl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc(N2CC3CCCNC3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N4O4/c18-16(19)10-3-4-12(13(6-10)17(20)21)15-7-9-2-1-5-14-11(9)8-15/h3-4,6,9,11,14H,1-2,5,7-8H2 |
| InChIKey | VMPNIJANVOLISR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|