C13H17N3O4 — CID 7275416
(3S,5S)-1-(2,4-dinitrophenyl)-3,5-dimethylpiperidine (PubChem CID 7275416) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is (3S,5S)-1-(2,4-dinitrophenyl)-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-(2,4-dinitrophenyl)-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 7275416 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (3S,5S)-1-(2,4-dinitrophenyl)-3,5-dimethylpiperidine |
| SMILES | C[C@H]1C[C@H](C)CN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H17N3O4/c1-9-5-10(2)8-14(7-9)12-4-3-11(15(17)18)6-13(12)16(19)20/h3-4,6,9-10H,5,7-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | NMSOTJKUTBWPAD-UWVGGRQHSA-N |
| XLogP | 2.99 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|